| MolName | 1-benzyl-3-[(Z)-[1-[2-(4-bromophenoxy)ethyl]indol-3-yl]methylideneamino]thiourea |
| MolecularFormula | C25H23N4OBrS |
| Smiles | S=C(NCc1ccccc1)N/N=C\c1cn(CCOc(cc2)ccc2Br)c2c1cccc2 |
| InChI | InChI=1S/C25H23BrN4OS/c26-21-10-12-22(13-11-21)31-15-14-30-18-20(23-8-4-5-9-24(23)30)17-28-29-25(32)27-16-19-6-2-1-3-7-19/h1-13,17-18H,14-16H2,(H2,27,29,32) |
| InChIK | APTCHWWQRROYAR-UHFFFAOYSA-N |
| TotalMolweight | 507.455 |
| Molweight | 507.455 |
| MonoisotopicMass | 506.077592 |
| CLogP | 5.4737 |
| CLogS | -6.114 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 366.88 |
| Relative PSA | 0.21615 |
| PolarSurfaceArea | 82.67 |
| Druglikeness | 2.7358 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.65625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-benzyl-3-[(Z)-[1-[2-(4-bromophenoxy)ethyl]indol-3-yl]methylideneamino]thiourea | 2 - 1-benzyl-3-[(Z)-[1-[2-(4-bromophenoxy)ethyl]indol-3-yl]methylideneamino]thiourea