| MolName | 2-[(Z)-(2-chlorophenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
| MolecularFormula | C24H15N2OCl |
| Smiles | N#Cc1c(/N=C\c(cccc2)c2Cl)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H15ClN2O/c25-21-14-8-7-13-19(21)16-27-24-20(15-26)22(17-9-3-1-4-10-17)23(28-24)18-11-5-2-6-12-18/h1-14,16H |
| InChIK | AQCGLONIKRDOAD-UHFFFAOYSA-N |
| TotalMolweight | 382.849 |
| Molweight | 382.849 |
| MonoisotopicMass | 382.08729 |
| CLogP | 6.3705 |
| CLogS | -8.714 |
| H Acceptors | 3 |
| TotalSurfaceArea | 304.12 |
| Relative PSA | 0.12883 |
| PolarSurfaceArea | 49.29 |
| Druglikeness | -3.6115 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-(2-chlorophenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile | 2 - 2-[(Z)-(2-chlorophenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile