| MolName | N-[(E)-furan-2-ylmethylideneamino]pyridin-2-amine |
| MolecularFormula | C10H9N3O |
| Smiles | C(c1ccco1)=N/Nc1ncccc1 |
| InChI | InChI=1S/C10H9N3O/c1-2-6-11-10(5-1)13-12-8-9-4-3-7-14-9/h1-8H,(H,11,13) |
| InChIK | AQQBIFLQQZWBQB-UHFFFAOYSA-N |
| TotalMolweight | 187.201 |
| Molweight | 187.201 |
| MonoisotopicMass | 187.074562 |
| CLogP | 3.3801 |
| CLogS | -2.561 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 157.69 |
| Relative PSA | 0.30471 |
| PolarSurfaceArea | 50.42 |
| Druglikeness | 1.8312 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-furan-2-ylmethylideneamino]pyridin-2-amine | 2 - N-[(E)-furan-2-ylmethylideneamino]pyridin-2-amine