| MolName | 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-[5-(4-fluorophenyl)furan-2-yl]methylideneamino]benzamide |
| MolecularFormula | C24H17N3O4ClFS |
| Smiles | O=C(c1cccc(S(Nc(cc2)ccc2Cl)(=O)=O)c1)N/N=C\c1ccc(-c(cc2)ccc2F)o1 |
| InChI | InChI=1S/C24H17ClFN3O4S/c25-18-6-10-20(11-7-18)29-34(31,32)22-3-1-2-17(14-22)24(30)28-27-15-21-12-13-23(33-21)16-4-8-19(26)9-5-16/h1-15,29H,(H,28,30) |
| InChIK | AQXDYUCGQOZGMN-UHFFFAOYSA-N |
| TotalMolweight | 497.933 |
| Molweight | 497.933 |
| MonoisotopicMass | 497.061232 |
| CLogP | 5.1464 |
| CLogS | -7.564 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 358.01 |
| Relative PSA | 0.25184 |
| PolarSurfaceArea | 109.15 |
| Druglikeness | 2.6845 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-[5-(4-fluorophenyl)furan-2-yl]methylideneamino]benzamide | 2 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-[5-(4-fluorophenyl)furan-2-yl]methylideneamino]benzamide