| MolName | 2-(5-aminotetrazol-2-yl)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C17H17N7O2 |
| Smiles | Nc1nn(CC(N/N=C\c(cccc2)c2OCc2ccccc2)=O)nn1 |
| InChI | InChI=1S/C17H17N7O2/c18-17-21-23-24(22-17)11-16(25)20-19-10-14-8-4-5-9-15(14)26-12-13-6-2-1-3-7-13/h1-10H,11-12H2,(H2,18,22)(H,20,25) |
| InChIK | AREBMBPRCBEJGI-UHFFFAOYSA-N |
| TotalMolweight | 351.369 |
| Molweight | 351.369 |
| MonoisotopicMass | 351.144373 |
| CLogP | 1.9102 |
| CLogS | -3.332 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 278.27 |
| Relative PSA | 0.36317 |
| PolarSurfaceArea | 120.31 |
| Druglikeness | 0.77733 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-aminotetrazol-2-yl)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide | 2 - 2-(5-aminotetrazol-2-yl)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide