| MolName | N-[(Z)-3-phenylpropylideneamino]pyridine-3-carboxamide |
| MolecularFormula | C15H15N3O |
| Smiles | O=C(c1cnccc1)N/N=C\CCc1ccccc1 |
| InChI | InChI=1S/C15H15N3O/c19-15(14-9-5-10-16-12-14)18-17-11-4-8-13-6-2-1-3-7-13/h1-3,5-7,9-12H,4,8H2,(H,18,19) |
| InChIK | AREQQQXTLHSTBW-UHFFFAOYSA-N |
| TotalMolweight | 253.304 |
| Molweight | 253.304 |
| MonoisotopicMass | 253.121512 |
| CLogP | 2.3423 |
| CLogS | -3.083 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 213.27 |
| Relative PSA | 0.22028 |
| PolarSurfaceArea | 54.35 |
| Druglikeness | 3.2723 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73684 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-3-phenylpropylideneamino]pyridine-3-carboxamide | 2 - N-[(Z)-3-phenylpropylideneamino]pyridine-3-carboxamide