| MolName | N'-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide |
| MolecularFormula | C25H18N3O4Cl |
| Smiles | O=C(C(N/N=C/c1ccc(-c2cccc(Cl)c2)o1)=O)Nc(cc1)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C25H18ClN3O4/c26-18-6-4-5-17(15-18)23-14-13-22(33-23)16-27-29-25(31)24(30)28-19-9-11-21(12-10-19)32-20-7-2-1-3-8-20/h1-16H,(H,28,30)(H,29,31) |
| InChIK | ARFBEYZFUPLKIO-UHFFFAOYSA-N |
| TotalMolweight | 459.888 |
| Molweight | 459.888 |
| MonoisotopicMass | 459.098584 |
| CLogP | 5.0844 |
| CLogS | -8.018 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 350.83 |
| Relative PSA | 0.2412 |
| PolarSurfaceArea | 92.93 |
| Druglikeness | 5.6688 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide | 2 - N'-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide