| MolName | [3-[(Z)-[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| MolecularFormula | C27H21N3O5 |
| Smiles | O=C(CNc1cccc2ccccc12)N/N=C\c1cccc(OC(c(cc2)cc3c2OCO3)=O)c1 |
| InChI | InChI=1S/C27H21N3O5/c31-26(16-28-23-10-4-7-19-6-1-2-9-22(19)23)30-29-15-18-5-3-8-21(13-18)35-27(32)20-11-12-24-25(14-20)34-17-33-24/h1-15,28H,16-17H2,(H,30,31) |
| InChIK | ARHQLGMMMJREOY-UHFFFAOYSA-N |
| TotalMolweight | 467.48 |
| Molweight | 467.48 |
| MonoisotopicMass | 467.148122 |
| CLogP | 5.2298 |
| CLogS | -7.33 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 354.58 |
| Relative PSA | 0.25526 |
| PolarSurfaceArea | 98.25 |
| Druglikeness | 4.635 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 5 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate | 2 - [3-[(Z)-[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate