| MolName | 4-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C22H15N7O2S2 |
| Smiles | [O-][N+](c(cc1)ccc1-c(c(/C=N\N(C(c1cccs1)=NN1)C1=S)c1)nn1-c1ccccc1)=O |
| InChI | InChI=1S/C22H15N7O2S2/c30-29(31)18-10-8-15(9-11-18)20-16(14-27(26-20)17-5-2-1-3-6-17)13-23-28-21(24-25-22(28)32)19-7-4-12-33-19/h1-14H,(H,25,32) |
| InChIK | ARJQCZAEQUEAPX-UHFFFAOYSA-N |
| TotalMolweight | 473.54 |
| Molweight | 473.54 |
| MonoisotopicMass | 473.072863 |
| CLogP | 3.159 |
| CLogS | -6.434 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 348.81 |
| Relative PSA | 0.38603 |
| PolarSurfaceArea | 163.96 |
| Druglikeness | 0.54919 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.45455 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione