| MolName | (Z)-N-[(Z)-(2-chlorophenyl)methylideneamino]-1,1-diphenylmethanimine |
| MolecularFormula | C20H15N2Cl |
| Smiles | Clc1c(/C=N\N=C(c2ccccc2)c2ccccc2)cccc1 |
| InChI | InChI=1S/C20H15ClN2/c21-19-14-8-7-13-18(19)15-22-23-20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-15H |
| InChIK | ARPOXCMVMFZYMK-UHFFFAOYSA-N |
| TotalMolweight | 318.806 |
| Molweight | 318.806 |
| MonoisotopicMass | 318.092375 |
| CLogP | 6.5883 |
| CLogS | -6.644 |
| H Acceptors | 2 |
| TotalSurfaceArea | 255.93 |
| Relative PSA | 0.089946 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | 1.9262 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.52174 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-(2-chlorophenyl)methylideneamino]-1,1-diphenylmethanimine | 2 - (Z)-N-[(Z)-(2-chlorophenyl)methylideneamino]-1,1-diphenylmethanimine