| MolName | 4-[(2Z)-2-[(2Z)-2-[(4-sulfophenyl)hydrazinylidene]ethylidene]hydrazinyl]benzenesulfonic acid |
| MolecularFormula | C14H14N4O6S2 |
| Smiles | OS(c(cc1)ccc1N/N=C\C=N/Nc(cc1)ccc1S(O)(=O)=O)(=O)=O |
| InChI | InChI=1S/C14H14N4O6S2/c19-25(20,21)13-5-1-11(2-6-13)17-15-9-10-16-18-12-3-7-14(8-4-12)26(22,23)24/h1-10,17-18H,(H,19,20,21)(H,22,23,24) |
| InChIK | ASMDMBOJMDHBBC-UHFFFAOYSA-N |
| TotalMolweight | 398.419 |
| Molweight | 398.419 |
| MonoisotopicMass | 398.035476 |
| CLogP | 0.7366 |
| CLogS | -0.03 |
| H Acceptors | 10 |
| H Donors | 4 |
| TotalSurfaceArea | 275.32 |
| Relative PSA | 0.46964 |
| PolarSurfaceArea | 174.28 |
| Druglikeness | 0.6845 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 16 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[(2Z)-2-[(4-sulfophenyl)hydrazinylidene]ethylidene]hydrazinyl]benzenesulfonic acid | 2 - 4-[(2Z)-2-[(2Z)-2-[(4-sulfophenyl)hydrazinylidene]ethylidene]hydrazinyl]benzenesulfonic acid