| MolName | (Z)-1-[(3E)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]-N-[(Z)-quinoxalin-2-ylmethylideneamino]methanimine |
| MolecularFormula | C26H24N6O3 |
| Smiles | [O-][N+](c1cc(/C=C(\CC2)/C(N3CCOCC3)=C2/C=N\N=C/c2nc3ccccc3nc2)ccc1)=O |
| InChI | InChI=1S/C26H24N6O3/c33-32(34)23-5-3-4-19(15-23)14-20-8-9-21(26(20)31-10-12-35-13-11-31)16-28-29-18-22-17-27-24-6-1-2-7-25(24)30-22/h1-7,14-18H,8-13H2 |
| InChIK | ASOLJKNUAJTZKU-UHFFFAOYSA-N |
| TotalMolweight | 468.516 |
| Molweight | 468.516 |
| MonoisotopicMass | 468.190989 |
| CLogP | 3.9351 |
| CLogS | -4.988 |
| H Acceptors | 9 |
| TotalSurfaceArea | 361.82 |
| Relative PSA | 0.24579 |
| PolarSurfaceArea | 108.79 |
| Druglikeness | -2.277 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[(3E)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]-N-[(Z)-quinoxalin-2-ylmethylideneamino]methanimine | 2 - (Z)-1-[(3E)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]-N-[(Z)-quinoxalin-2-ylmethylideneamino]methanimine