| MolName | (4E)-2-[[2-(5-bromonaphthalen-1-yl)-1,3-benzoxazol-5-yl]iminomethyl]-4-(naphthalen-1-ylhydrazinylidene)cyclohexa-2,5-dien-1-one |
| MolecularFormula | C34H21N4O2Br |
| Smiles | O=C(C=C1)C(/C=N/c(cc2)cc3c2oc(-c2c(cccc4Br)c4ccc2)n3)=C/C1=N/Nc1cccc2ccccc12 |
| InChI | InChI=1S/C34H21BrN4O2/c35-29-12-5-9-26-27(29)10-4-11-28(26)34-37-31-19-23(15-17-33(31)41-34)36-20-22-18-24(14-16-32(22)40)38-39-30-13-3-7-21-6-1-2-8-25(21)30/h1-20,39H |
| InChIK | ASUVQFBYFMNXRR-UHFFFAOYSA-N |
| TotalMolweight | 597.471 |
| Molweight | 597.471 |
| MonoisotopicMass | 596.084787 |
| CLogP | 8.8429 |
| CLogS | -10.293 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 418.31 |
| Relative PSA | 0.17356 |
| PolarSurfaceArea | 79.85 |
| Druglikeness | 1.6692 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | twice activated DB; imine/hydrazone of aldehyde |
| Shape Index | 0.53659 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 29 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (4E)-2-[[2-(5-bromonaphthalen-1-yl)-1,3-benzoxazol-5-yl]iminomethyl]-4-(naphthalen-1-ylhydrazinylidene)cyclohexa-2,5-dien-1-one | 2 - (4E)-2-[[2-(5-bromonaphthalen-1-yl)-1,3-benzoxazol-5-yl]iminomethyl]-4-(naphthalen-1-ylhydrazinylidene)cyclohexa-2,5-dien-1-one