| MolName | N-[(Z)-(4-chlorophenyl)methylideneamino]-2-(1-oxo-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazin-2-yl)acetamide |
| MolecularFormula | C18H14N5O2ClS |
| Smiles | O=C(CN(C1=O)N=C2N1c(cccc1)c1SC2)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C18H14ClN5O2S/c19-13-7-5-12(6-8-13)9-20-21-17(25)10-23-18(26)24-14-3-1-2-4-15(14)27-11-16(24)22-23/h1-9H,10-11H2,(H,21,25) |
| InChIK | ATCMWPAVFIBPQD-UHFFFAOYSA-N |
| TotalMolweight | 399.861 |
| Molweight | 399.861 |
| MonoisotopicMass | 399.055672 |
| CLogP | 2.2862 |
| CLogS | -5.809 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 281.74 |
| Relative PSA | 0.30223 |
| PolarSurfaceArea | 102.67 |
| Druglikeness | 7.1751 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-(1-oxo-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazin-2-yl)acetamide | 2 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-(1-oxo-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazin-2-yl)acetamide