| MolName | 2-(azepan-1-yl)-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-oxoacetamide |
| MolecularFormula | C15H18N3O2Cl |
| Smiles | O=C(C(N1CCCCCC1)=O)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C15H18ClN3O2/c16-13-7-5-12(6-8-13)11-17-18-14(20)15(21)19-9-3-1-2-4-10-19/h5-8,11H,1-4,9-10H2,(H,18,20) |
| InChIK | ATGKBKDXOLFGOO-UHFFFAOYSA-N |
| TotalMolweight | 307.78 |
| Molweight | 307.78 |
| MonoisotopicMass | 307.108754 |
| CLogP | 2.7827 |
| CLogS | -3.618 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 239.76 |
| Relative PSA | 0.21939 |
| PolarSurfaceArea | 61.77 |
| Druglikeness | 1.0609 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(azepan-1-yl)-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-oxoacetamide | 2 - 2-(azepan-1-yl)-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-oxoacetamide