| MolName | 3-(2,4-dichlorophenyl)-4-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C22H16N4OCl2S |
| Smiles | S=C(NN=C1c(ccc(Cl)c2)c2Cl)N1/N=C\c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H16Cl2N4OS/c23-17-8-11-19(20(24)12-17)21-26-27-22(30)28(21)25-13-15-6-9-18(10-7-15)29-14-16-4-2-1-3-5-16/h1-13H,14H2,(H,27,30) |
| InChIK | ATLAYYSADJPFQP-UHFFFAOYSA-N |
| TotalMolweight | 455.368 |
| Molweight | 455.368 |
| MonoisotopicMass | 454.042185 |
| CLogP | 5.8551 |
| CLogS | -7.264 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 336.08 |
| Relative PSA | 0.22623 |
| PolarSurfaceArea | 81.31 |
| Druglikeness | 3.229 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2,4-dichlorophenyl)-4-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(2,4-dichlorophenyl)-4-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione