| MolName | 1-[(Z)-benzylideneamino]-3-(4-piperidin-1-ylsulfonylphenyl)thiourea |
| MolecularFormula | C19H22N4O2S2 |
| Smiles | O=S(c(cc1)ccc1NC(N/N=C\c1ccccc1)=S)(N1CCCCC1)=O |
| InChI | InChI=1S/C19H22N4O2S2/c24-27(25,23-13-5-2-6-14-23)18-11-9-17(10-12-18)21-19(26)22-20-15-16-7-3-1-4-8-16/h1,3-4,7-12,15H,2,5-6,13-14H2,(H2,21,22,26) |
| InChIK | ATMXEHNXGHYDBC-UHFFFAOYSA-N |
| TotalMolweight | 402.542 |
| Molweight | 402.542 |
| MonoisotopicMass | 402.118416 |
| CLogP | 3.799 |
| CLogS | -4.416 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 307.59 |
| Relative PSA | 0.30742 |
| PolarSurfaceArea | 114.27 |
| Druglikeness | 3.1058 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 7 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-benzylideneamino]-3-(4-piperidin-1-ylsulfonylphenyl)thiourea | 2 - 1-[(Z)-benzylideneamino]-3-(4-piperidin-1-ylsulfonylphenyl)thiourea