| MolName | (E)-3-phenyl-N-[6-[[(E)-3-phenylprop-2-enylidene]amino]hexyl]prop-2-en-1-imine |
| MolecularFormula | C24H28N2 |
| Smiles | C(CCC/N=C/C=C/c1ccccc1)CC/N=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H28N2/c1(9-19-25-21-11-17-23-13-5-3-6-14-23)2-10-20-26-22-12-18-24-15-7-4-8-16-24/h3-8,11-18,21-22H,1-2,9-10,19-20H2/b17-11?,18-12?,25-21+,26-22? |
| InChIK | ATPFMBHTMKBVLS-MOEAGGLISA-N |
| TotalMolweight | 344.5 |
| Molweight | 344.5 |
| MonoisotopicMass | 344.225248 |
| CLogP | 5.1282 |
| CLogS | -5.272 |
| H Acceptors | 2 |
| TotalSurfaceArea | 318.1 |
| Relative PSA | 0.072367 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | -3.9692 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.84615 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 2 |
| Electronegative Atoms | 2 |
| Rotatable Bond | 11 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 15 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (E)-3-phenyl-N-[6-[[(E)-3-phenylprop-2-enylidene]amino]hexyl]prop-2-en-1-imine | 2 - (E)-3-phenyl-N-[6-[[(E)-3-phenylprop-2-enylidene]amino]hexyl]prop-2-en-1-imine