| MolName | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C21H16N5OBrS2 |
| Smiles | O=C(CSc1nnc(-c2ccccc2)n1-c(cc1)ccc1Br)N/N=C\c1cccs1 |
| InChI | InChI=1S/C21H16BrN5OS2/c22-16-8-10-17(11-9-16)27-20(15-5-2-1-3-6-15)25-26-21(27)30-14-19(28)24-23-13-18-7-4-12-29-18/h1-13H,14H2,(H,24,28) |
| InChIK | AUIDUKIATZTRTG-UHFFFAOYSA-N |
| TotalMolweight | 498.428 |
| Molweight | 498.428 |
| MonoisotopicMass | 496.997961 |
| CLogP | 5.1236 |
| CLogS | -9.26 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 339.05 |
| Relative PSA | 0.30282 |
| PolarSurfaceArea | 125.71 |
| Druglikeness | 4.9129 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide | 2 - 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide