| MolName | N,N'-bis[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]pentanediamide |
| MolecularFormula | C21H18N4O6Br2 |
| Smiles | O=C(CCCC(N/N=C\c(cc1OCOc1c1)c1Br)=O)N/N=C\c(cc1OCOc1c1)c1Br |
| InChI | InChI=1S/C21H18Br2N4O6/c22-14-6-18-16(30-10-32-18)4-12(14)8-24-26-20(28)2-1-3-21(29)27-25-9-13-5-17-19(7-15(13)23)33-11-31-17/h4-9H,1-3,10-11H2,(H,26,28)(H,27,29) |
| InChIK | AUIFTLRPTAEPGR-UHFFFAOYSA-N |
| TotalMolweight | 582.204 |
| Molweight | 582.204 |
| MonoisotopicMass | 579.959308 |
| CLogP | 5.5748 |
| CLogS | -8.018 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 360.02 |
| Relative PSA | 0.31115 |
| PolarSurfaceArea | 119.84 |
| Druglikeness | -3.1869 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 16 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]pentanediamide | 2 - N,N'-bis[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]pentanediamide