| MolName | (15S,19R)-17-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| MolecularFormula | C29H19N2O3Cl |
| Smiles | O=C([C@H]([C@@H](C1c2c3cccc2)C2=O)C3c3c1cccc3)N2/N=C\c1ccc(-c(cc2)ccc2Cl)o1 |
| InChI | InChI=1S/C29H19ClN2O3/c30-17-11-9-16(10-12-17)23-14-13-18(35-23)15-31-32-28(33)26-24-19-5-1-2-6-20(19)25(27(26)29(32)34)22-8-4-3-7-21(22)24/h1-15,24-27H/t24?,25?,26-,27+ |
| InChIK | AUOCMUNWYPFROH-LEABRGHYSA-N |
| TotalMolweight | 478.934 |
| Molweight | 478.934 |
| MonoisotopicMass | 478.10842 |
| CLogP | 4.6478 |
| CLogS | -7.326 |
| H Acceptors | 5 |
| TotalSurfaceArea | 337.71 |
| Relative PSA | 0.1636 |
| PolarSurfaceArea | 62.88 |
| Druglikeness | 7.1369 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| StereoCenters | 2 |
| Rotatable Bond | 3 |
| Rings Closures | 7 |
| Small Rings | 8 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 8 |
| StereoCon | meso |
Click to Load Molecule:
1 - (15S,19R)-17-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione | 2 - (15S,19R)-17-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione