| MolName | (Z)-1-[2-(5-nitrothiophen-2-yl)-1,3-thiazol-4-yl]-N-piperidin-1-ylmethanimine |
| MolecularFormula | C13H14N4O2S2 |
| Smiles | [O-][N+](c1ccc(-c2nc(/C=N\N3CCCCC3)cs2)s1)=O |
| InChI | InChI=1S/C13H14N4O2S2/c18-17(19)12-5-4-11(21-12)13-15-10(9-20-13)8-14-16-6-2-1-3-7-16/h4-5,8-9H,1-3,6-7H2 |
| InChIK | AUPXNTKSQROOGH-UHFFFAOYSA-N |
| TotalMolweight | 322.412 |
| Molweight | 322.412 |
| MonoisotopicMass | 322.055816 |
| CLogP | 2.6561 |
| CLogS | -3.602 |
| H Acceptors | 6 |
| TotalSurfaceArea | 237.69 |
| Relative PSA | 0.40881 |
| PolarSurfaceArea | 130.79 |
| Druglikeness | -1.0673 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[2-(5-nitrothiophen-2-yl)-1,3-thiazol-4-yl]-N-piperidin-1-ylmethanimine | 2 - (Z)-1-[2-(5-nitrothiophen-2-yl)-1,3-thiazol-4-yl]-N-piperidin-1-ylmethanimine