| MolName | [(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]urea |
| MolecularFormula | C9H9N3O2F2 |
| Smiles | NC(N/N=C\c(cc1)ccc1OC(F)F)=O |
| InChI | InChI=1S/C9H9F2N3O2/c10-8(11)16-7-3-1-6(2-4-7)5-13-14-9(12)15/h1-5,8H,(H3,12,14,15) |
| InChIK | AUWOPSFQGPVGFE-UHFFFAOYSA-N |
| TotalMolweight | 229.185 |
| Molweight | 229.185 |
| MonoisotopicMass | 229.066283 |
| CLogP | 1.3047 |
| CLogS | -3.436 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 170.95 |
| Relative PSA | 0.35847 |
| PolarSurfaceArea | 76.71 |
| Druglikeness | 1.3825 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]urea | 2 - [(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]urea