| MolName | [4-bromo-2-[(Z)-[(2-fluorobenzoyl)hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C21H14N2O3BrF |
| Smiles | O=C(c(cccc1)c1F)N/N=C\c(cc(cc1)Br)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C21H14BrFN2O3/c22-16-10-11-19(28-21(27)14-6-2-1-3-7-14)15(12-16)13-24-25-20(26)17-8-4-5-9-18(17)23/h1-13H,(H,25,26) |
| InChIK | AUZLBQWMFLXIQY-UHFFFAOYSA-N |
| TotalMolweight | 441.255 |
| Molweight | 441.255 |
| MonoisotopicMass | 440.017182 |
| CLogP | 5.4581 |
| CLogS | -6.339 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 299.48 |
| Relative PSA | 0.19718 |
| PolarSurfaceArea | 67.76 |
| Druglikeness | 0.86759 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[(2-fluorobenzoyl)hydrazinylidene]methyl]phenyl] benzoate | 2 - [4-bromo-2-[(Z)-[(2-fluorobenzoyl)hydrazinylidene]methyl]phenyl] benzoate