| MolName | [2-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C25H17N2O4Cl |
| Smiles | Oc1cc2ccccc2cc1C(N/N=C\c(cccc1)c1OC(c(cc1)ccc1Cl)=O)=O |
| InChI | InChI=1S/C25H17ClN2O4/c26-20-11-9-16(10-12-20)25(31)32-23-8-4-3-7-19(23)15-27-28-24(30)21-13-17-5-1-2-6-18(17)14-22(21)29/h1-15,29H,(H,28,30) |
| InChIK | AVCHKEGJIKWHJH-UHFFFAOYSA-N |
| TotalMolweight | 444.873 |
| Molweight | 444.873 |
| MonoisotopicMass | 444.087685 |
| CLogP | 6.0868 |
| CLogS | -7.237 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 330.87 |
| Relative PSA | 0.21806 |
| PolarSurfaceArea | 87.99 |
| Druglikeness | 4.0444 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [2-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate