| MolName | N-[(Z)-benzylideneamino]-2-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetamide |
| MolecularFormula | C29H34N4O |
| Smiles | O=C(CN1[C@H](CCC2)c3c2c(cc(C2CCCCC2)cc2)c2n3CC1)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C29H34N4O/c34-28(31-30-19-21-8-3-1-4-9-21)20-32-16-17-33-26-15-14-23(22-10-5-2-6-11-22)18-25(26)24-12-7-13-27(32)29(24)33/h1,3-4,8-9,14-15,18-19,22,27H,2,5-7,10-13,16-17,20H2,(H,31,34)/t27-/m1/s1 |
| InChIK | AVFISANCMIGZNB-HHHXNRCGSA-N |
| TotalMolweight | 454.616 |
| Molweight | 454.616 |
| MonoisotopicMass | 454.273261 |
| CLogP | 6.5927 |
| CLogS | -5.487 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 356.95 |
| Relative PSA | 0.13007 |
| PolarSurfaceArea | 49.63 |
| Druglikeness | 2.0514 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| StereoCenters | 1 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 14 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]-2-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetamide | 2 - N-[(Z)-benzylideneamino]-2-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetamide