| MolName | N-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| MolecularFormula | C22H24N2O2 |
| Smiles | OC(C(N/N=C\[C@@H]1[C@H](CC2)C[C@H]2C1)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2/c25-21(24-23-15-18-14-16-11-12-17(18)13-16)22(26,19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-10,15-18,26H,11-14H2,(H,24,25)/t16-,17+,18+/m0/s1 |
| InChIK | AVOCCHZHHHQNLQ-RCCFBDPRSA-N |
| TotalMolweight | 348.445 |
| Molweight | 348.445 |
| MonoisotopicMass | 348.183778 |
| CLogP | 2.9747 |
| CLogS | -4.641 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 269.29 |
| Relative PSA | 0.18237 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 4.6766 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| StereoCenters | 3 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 8 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - N-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide | 2 - N-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide