| MolName | 2-(2-nitrophenoxy)-N-[(Z)-[(2Z)-2-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]ethylidene]amino]acetamide |
| MolecularFormula | C18H16N6O8 |
| Smiles | [O-][N+](c(cccc1)c1OCC(N/N=C\C=N/NC(COc(cccc1)c1[N+]([O-])=O)=O)=O)=O |
| InChI | InChI=1S/C18H16N6O8/c25-17(11-31-15-7-3-1-5-13(15)23(27)28)21-19-9-10-20-22-18(26)12-32-16-8-4-2-6-14(16)24(29)30/h1-10H,11-12H2,(H,21,25)(H,22,26) |
| InChIK | AWJBOAUDKCDOKF-UHFFFAOYSA-N |
| TotalMolweight | 444.359 |
| Molweight | 444.359 |
| MonoisotopicMass | 444.102964 |
| CLogP | -0.7768 |
| CLogS | -4.442 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 335.82 |
| Relative PSA | 0.45518 |
| PolarSurfaceArea | 193.02 |
| Druglikeness | -0.93238 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 11 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 16 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-nitrophenoxy)-N-[(Z)-[(2Z)-2-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]ethylidene]amino]acetamide | 2 - 2-(2-nitrophenoxy)-N-[(Z)-[(2Z)-2-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]ethylidene]amino]acetamide