| MolName | [2-[(Z)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] 3-fluorobenzoate |
| MolecularFormula | C28H18N3O4Br2FS |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C\c1cccs1)N/N=C\c1cc(Br)cc(Br)c1OC(c1cc(F)ccc1)=O |
| InChI | InChI=1S/C28H18Br2FN3O4S/c29-20-12-19(25(23(30)14-20)38-28(37)18-8-4-9-21(31)13-18)16-32-34-27(36)24(15-22-10-5-11-39-22)33-26(35)17-6-2-1-3-7-17/h1-16H,(H,33,35)(H,34,36) |
| InChIK | AWNISFMLTOFHNJ-UHFFFAOYSA-N |
| TotalMolweight | 671.34 |
| Molweight | 671.34 |
| MonoisotopicMass | 668.936877 |
| CLogP | 7.6666 |
| CLogS | -8.928 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 427.73 |
| Relative PSA | 0.24293 |
| PolarSurfaceArea | 125.1 |
| Druglikeness | 4.2522 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48718 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] 3-fluorobenzoate | 2 - [2-[(Z)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] 3-fluorobenzoate