| MolName | 3-[(Z)-[[4-(3-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol |
| MolecularFormula | C20H20N4O4S2 |
| Smiles | Oc1cccc(/C=N\Nc2nc(-c3cccc(S(N4CCOCC4)(=O)=O)c3)cs2)c1 |
| InChI | InChI=1S/C20H20N4O4S2/c25-17-5-1-3-15(11-17)13-21-23-20-22-19(14-29-20)16-4-2-6-18(12-16)30(26,27)24-7-9-28-10-8-24/h1-6,11-14,25H,7-10H2,(H,22,23) |
| InChIK | AWRIRZBKZPIFNI-UHFFFAOYSA-N |
| TotalMolweight | 444.535 |
| Molweight | 444.535 |
| MonoisotopicMass | 444.092596 |
| CLogP | 4.9135 |
| CLogS | -3.57 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 320.47 |
| Relative PSA | 0.34178 |
| PolarSurfaceArea | 140.74 |
| Druglikeness | 1.1931 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 7 |
| Symmetricatoms | 3 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[[4-(3-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol | 2 - 3-[(Z)-[[4-(3-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol