| MolName | 4-chloro-2-nitro-6-[(Z)-[[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]hydrazinylidene]methyl]phenolate |
| MolecularFormula | C11H7N7O6Cl |
| Smiles | [O-]c(c(/C=N\NC(Cn(cn1)nc1[N+]([O-])=O)=O)cc(Cl)c1)c1[N+]([O-])=O |
| InChI | InChI=1S/C11H8ClN7O6/c12-7-1-6(10(21)8(2-7)18(22)23)3-14-15-9(20)4-17-5-13-11(16-17)19(24)25/h1-3,5,21H,4H2,(H,15,20)/p-1 |
| InChIK | AXANLAATOSNVAI-UHFFFAOYSA-M |
| TotalMolweight | 368.673 |
| Molweight | 368.673 |
| MonoisotopicMass | 368.014635 |
| CLogP | -2.1566 |
| CLogS | -3.963 |
| H Acceptors | 13 |
| H Donors | 1 |
| TotalSurfaceArea | 257.76 |
| Relative PSA | 0.54291 |
| PolarSurfaceArea | 186.87 |
| Druglikeness | 1.3494 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-2-nitro-6-[(Z)-[[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]hydrazinylidene]methyl]phenolate | 2 - 4-chloro-2-nitro-6-[(Z)-[[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]hydrazinylidene]methyl]phenolate