| MolName | 2-hydroxy-5-[[4-[(E)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl]methylideneamino]benzoic acid |
| MolecularFormula | C20H14N4O7 |
| Smiles | [O-][N+](C(C(N1)=O)=C(/C=C/c2ccc(/C=N/c(cc3)cc(C(O)=O)c3O)cc2)NC1=O)=O |
| InChI | InChI=1S/C20H14N4O7/c25-16-8-6-13(9-14(16)19(27)28)21-10-12-3-1-11(2-4-12)5-7-15-17(24(30)31)18(26)23-20(29)22-15/h1-10,25H,(H,27,28)(H2,22,23,26,29) |
| InChIK | AXDDCBDGJUHDBK-UHFFFAOYSA-N |
| TotalMolweight | 422.352 |
| Molweight | 422.352 |
| MonoisotopicMass | 422.086251 |
| CLogP | 0.8092 |
| CLogS | -4.665 |
| H Acceptors | 11 |
| H Donors | 4 |
| TotalSurfaceArea | 306.24 |
| Relative PSA | 0.42506 |
| PolarSurfaceArea | 173.91 |
| Druglikeness | -2.3979 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-5-[[4-[(E)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl]methylideneamino]benzoic acid | 2 - 2-hydroxy-5-[[4-[(E)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl]methylideneamino]benzoic acid