| MolName | N-[(Z)-(4-cyanophenyl)methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide |
| MolecularFormula | C26H18N4O3S |
| Smiles | N#Cc1ccc(/C=N\NC(c2ccc(CN(c3c(c4ccc5)c5ccc3)S4(=O)=O)cc2)=O)cc1 |
| InChI | InChI=1S/C26H18N4O3S/c27-15-18-7-9-19(10-8-18)16-28-29-26(31)22-13-11-20(12-14-22)17-30-23-5-1-3-21-4-2-6-24(25(21)23)34(30,32)33/h1-14,16H,17H2,(H,29,31) |
| InChIK | AYGYLFVYMPZDGL-UHFFFAOYSA-N |
| TotalMolweight | 466.52 |
| Molweight | 466.52 |
| MonoisotopicMass | 466.109961 |
| CLogP | 4.6322 |
| CLogS | -7.78 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 342.2 |
| Relative PSA | 0.23875 |
| PolarSurfaceArea | 111.01 |
| Druglikeness | -7.5856 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-cyanophenyl)methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide | 2 - N-[(Z)-(4-cyanophenyl)methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide