| MolName | N-[(E)-3-[(2Z)-2-[[5-(2-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| MolecularFormula | C25H18N3O3ClS |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C\c1cccs1)N/N=C\c1ccc(-c(cccc2)c2Cl)o1 |
| InChI | InChI=1S/C25H18ClN3O3S/c26-21-11-5-4-10-20(21)23-13-12-18(32-23)16-27-29-25(31)22(15-19-9-6-14-33-19)28-24(30)17-7-2-1-3-8-17/h1-16H,(H,28,30)(H,29,31) |
| InChIK | AYLXYPMDVRTTTB-UHFFFAOYSA-N |
| TotalMolweight | 475.955 |
| Molweight | 475.955 |
| MonoisotopicMass | 475.075739 |
| CLogP | 6.2298 |
| CLogS | -7.672 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 361.48 |
| Relative PSA | 0.26275 |
| PolarSurfaceArea | 111.94 |
| Druglikeness | 9.1339 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-3-[(2Z)-2-[[5-(2-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide | 2 - N-[(E)-3-[(2Z)-2-[[5-(2-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide