| MolName | N-[(Z)-(3-hydroxyphenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide |
| MolecularFormula | C24H18N4O3 |
| Smiles | Oc1cccc(/C=N\NC(C2=C(c3ccccc3)C(c3ccccc3)=NNC2=O)=O)c1 |
| InChI | InChI=1S/C24H18N4O3/c29-19-13-7-8-16(14-19)15-25-27-23(30)21-20(17-9-3-1-4-10-17)22(26-28-24(21)31)18-11-5-2-6-12-18/h1-15,29H,(H,27,30)(H,28,31) |
| InChIK | AYYUTNOCXOFDQC-UHFFFAOYSA-N |
| TotalMolweight | 410.432 |
| Molweight | 410.432 |
| MonoisotopicMass | 410.137891 |
| CLogP | 3.2685 |
| CLogS | -5.121 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 314.7 |
| Relative PSA | 0.27048 |
| PolarSurfaceArea | 103.15 |
| Druglikeness | 5.6393 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | twice activated DB; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-hydroxyphenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide | 2 - N-[(Z)-(3-hydroxyphenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide