| MolName | [4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| MolecularFormula | C25H29N7O3 |
| Smiles | O=C(c1ccco1)Oc1ccc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C25H29N7O3/c33-22(21-8-7-17-34-21)35-20-11-9-19(10-12-20)18-26-30-23-27-24(31-13-3-1-4-14-31)29-25(28-23)32-15-5-2-6-16-32/h7-12,17-18H,1-6,13-16H2,(H,27,28,29,30) |
| InChIK | AZCFVYFATYDKAX-UHFFFAOYSA-N |
| TotalMolweight | 475.551 |
| Molweight | 475.551 |
| MonoisotopicMass | 475.233188 |
| CLogP | 6.5477 |
| CLogS | -6.471 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 373.92 |
| Relative PSA | 0.26778 |
| PolarSurfaceArea | 108.98 |
| Druglikeness | 2.3083 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 11 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate | 2 - [4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate