| MolName | 3-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
| MolecularFormula | C19H11N3O2Cl2S |
| Smiles | O=C1Oc(cccc2)c2C=C1c1csc(N/N=C\c(ccc(Cl)c2)c2Cl)n1 |
| InChI | InChI=1S/C19H11Cl2N3O2S/c20-13-6-5-12(15(21)8-13)9-22-24-19-23-16(10-27-19)14-7-11-3-1-2-4-17(11)26-18(14)25/h1-10H,(H,23,24) |
| InChIK | AZEYKWGBQPOURL-UHFFFAOYSA-N |
| TotalMolweight | 416.287 |
| Molweight | 416.287 |
| MonoisotopicMass | 414.994901 |
| CLogP | 6.8252 |
| CLogS | -6.089 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 293.5 |
| Relative PSA | 0.26351 |
| PolarSurfaceArea | 91.82 |
| Druglikeness | 4.3896 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one | 2 - 3-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one