| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-[2-[(2Z)-2-[(3,5-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethoxy]acetamide |
| MolecularFormula | C18H14N4O3Cl4 |
| Smiles | O=C(COCC(N/N=C\c(ccc(Cl)c1)c1Cl)=O)N/N=C\c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H14Cl4N4O3/c19-13-2-1-12(16(22)6-13)8-24-26-18(28)10-29-9-17(27)25-23-7-11-3-14(20)5-15(21)4-11/h1-8H,9-10H2,(H,25,27)(H,26,28) |
| InChIK | AZTDNORIHJGXDV-UHFFFAOYSA-N |
| TotalMolweight | 476.146 |
| Molweight | 476.146 |
| MonoisotopicMass | 473.981999 |
| CLogP | 4.8699 |
| CLogS | -6.983 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 340.16 |
| Relative PSA | 0.24112 |
| PolarSurfaceArea | 92.15 |
| Druglikeness | 2.6178 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-[2-[(2Z)-2-[(3,5-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethoxy]acetamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-[2-[(2Z)-2-[(3,5-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethoxy]acetamide