| MolName | (Z)-(4-bromophenyl)methylidenehydrazine |
| MolecularFormula | C7H7N2Br |
| Smiles | N/N=C\c(cc1)ccc1Br |
| InChI | InChI=1S/C7H7BrN2/c8-7-3-1-6(2-4-7)5-10-9/h1-5H,9H2 |
| InChIK | BAJBVTWTYVBTIL-UHFFFAOYSA-N |
| TotalMolweight | 199.051 |
| Molweight | 199.051 |
| MonoisotopicMass | 197.979259 |
| CLogP | 2.292 |
| CLogS | -3.227 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 125.17 |
| Relative PSA | 0.21395 |
| PolarSurfaceArea | 38.38 |
| Druglikeness | -4.1246 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.8 |
| Fragments | 1 |
| Non HAtoms | 10 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 1 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-(4-bromophenyl)methylidenehydrazine | 2 - (Z)-(4-bromophenyl)methylidenehydrazine