| MolName | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide |
| MolecularFormula | C25H19N8O3Cl |
| Smiles | Nc1nonc1-n1nnc(-c2ccccc2)c1C(N/N=C\c(cc1)ccc1OCc(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C25H19ClN8O3/c26-19-10-6-17(7-11-19)15-36-20-12-8-16(9-13-20)14-28-30-25(35)22-21(18-4-2-1-3-5-18)29-33-34(22)24-23(27)31-37-32-24/h1-14H,15H2,(H2,27,31)(H,30,35) |
| InChIK | BANFSKGAQDPWGM-UHFFFAOYSA-N |
| TotalMolweight | 514.932 |
| Molweight | 514.932 |
| MonoisotopicMass | 514.126864 |
| CLogP | 5.3997 |
| CLogS | -5.283 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 387.9 |
| Relative PSA | 0.32519 |
| PolarSurfaceArea | 146.34 |
| Druglikeness | 1.7579 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56757 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide | 2 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide