| MolName | 2-hydroxy-N-[(Z)-[5-(4-oxo-3-phenylquinazolin-2-yl)sulfanylfuran-2-yl]methylideneamino]benzamide |
| MolecularFormula | C26H18N4O4S |
| Smiles | Oc(cccc1)c1C(N/N=C\c(o1)ccc1SC(N1c2ccccc2)=Nc(cccc2)c2C1=O)=O |
| InChI | InChI=1S/C26H18N4O4S/c31-22-13-7-5-11-20(22)24(32)29-27-16-18-14-15-23(34-18)35-26-28-21-12-6-4-10-19(21)25(33)30(26)17-8-2-1-3-9-17/h1-16,31H,(H,29,32) |
| InChIK | BBEMITVLPFRDBY-UHFFFAOYSA-N |
| TotalMolweight | 482.519 |
| Molweight | 482.519 |
| MonoisotopicMass | 482.104876 |
| CLogP | 4.9227 |
| CLogS | -6.917 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 357.56 |
| Relative PSA | 0.30431 |
| PolarSurfaceArea | 132.8 |
| Druglikeness | 7.5216 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-[5-(4-oxo-3-phenylquinazolin-2-yl)sulfanylfuran-2-yl]methylideneamino]benzamide | 2 - 2-hydroxy-N-[(Z)-[5-(4-oxo-3-phenylquinazolin-2-yl)sulfanylfuran-2-yl]methylideneamino]benzamide