| MolName | 3,5-dibromo-N-[(Z)-[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylideneamino]-2-hydroxybenzamide |
| MolecularFormula | C24H17N4O3Br2F |
| Smiles | Oc(c(C(N/N=C\c1cn(CC(Nc(cc2)ccc2F)=O)c2c1cccc2)=O)cc(Br)c1)c1Br |
| InChI | InChI=1S/C24H17Br2FN4O3/c25-15-9-19(23(33)20(26)10-15)24(34)30-28-11-14-12-31(21-4-2-1-3-18(14)21)13-22(32)29-17-7-5-16(27)6-8-17/h1-12,33H,13H2,(H,29,32)(H,30,34) |
| InChIK | BBWAUZVSQALDBP-UHFFFAOYSA-N |
| TotalMolweight | 588.23 |
| Molweight | 588.23 |
| MonoisotopicMass | 585.965141 |
| CLogP | 5.2214 |
| CLogS | -6.574 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 363.48 |
| Relative PSA | 0.22142 |
| PolarSurfaceArea | 95.72 |
| Druglikeness | 3.6083 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3,5-dibromo-N-[(Z)-[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylideneamino]-2-hydroxybenzamide | 2 - 3,5-dibromo-N-[(Z)-[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylideneamino]-2-hydroxybenzamide