| MolName | (Z)-1-(2,6-dichlorophenyl)-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanimine |
| MolecularFormula | C22H21N3Cl2 |
| Smiles | Clc1cccc(Cl)c1/C=N\N1CCN(Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C22H21Cl2N3/c23-21-9-4-10-22(24)20(21)15-25-27-13-11-26(12-14-27)16-18-7-3-6-17-5-1-2-8-19(17)18/h1-10,15H,11-14,16H2 |
| InChIK | BBXCKZDKXPXHFJ-UHFFFAOYSA-N |
| TotalMolweight | 398.336 |
| Molweight | 398.336 |
| MonoisotopicMass | 397.111251 |
| CLogP | 5.4254 |
| CLogS | -5.734 |
| H Acceptors | 3 |
| TotalSurfaceArea | 299.12 |
| Relative PSA | 0.062216 |
| PolarSurfaceArea | 18.84 |
| Druglikeness | 7.1365 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 7 |
| Symmetricatoms | 5 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(2,6-dichlorophenyl)-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanimine | 2 - (Z)-1-(2,6-dichlorophenyl)-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanimine