| MolName | [2-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
| MolecularFormula | C23H17N2O3Cl |
| Smiles | O=C(/C=C/c1ccccc1)Oc1c(/C=N\NC(c(cc2)ccc2Cl)=O)cccc1 |
| InChI | InChI=1S/C23H17ClN2O3/c24-20-13-11-18(12-14-20)23(28)26-25-16-19-8-4-5-9-21(19)29-22(27)15-10-17-6-2-1-3-7-17/h1-16H,(H,26,28) |
| InChIK | BBZQPESQDBIATP-UHFFFAOYSA-N |
| TotalMolweight | 404.852 |
| Molweight | 404.852 |
| MonoisotopicMass | 404.09277 |
| CLogP | 5.5673 |
| CLogS | -6.297 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 316.42 |
| Relative PSA | 0.18662 |
| PolarSurfaceArea | 67.76 |
| Druglikeness | 1.9167 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate | 2 - [2-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate