| MolName | 1-(4-fluorobenzoyl)-N-[(Z)-pyridin-4-ylmethylideneamino]piperidine-4-carboxamide |
| MolecularFormula | C19H19N4O2F |
| Smiles | O=C(C(CC1)CCN1C(c(cc1)ccc1F)=O)N/N=C\c1ccncc1 |
| InChI | InChI=1S/C19H19FN4O2/c20-17-3-1-16(2-4-17)19(26)24-11-7-15(8-12-24)18(25)23-22-13-14-5-9-21-10-6-14/h1-6,9-10,13,15H,7-8,11-12H2,(H,23,25) |
| InChIK | BCVOLFIXWWZNCA-UHFFFAOYSA-N |
| TotalMolweight | 354.384 |
| Molweight | 354.384 |
| MonoisotopicMass | 354.149204 |
| CLogP | 2.6477 |
| CLogS | -3.461 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 274.19 |
| Relative PSA | 0.23185 |
| PolarSurfaceArea | 74.66 |
| Druglikeness | 6.2808 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-fluorobenzoyl)-N-[(Z)-pyridin-4-ylmethylideneamino]piperidine-4-carboxamide | 2 - 1-(4-fluorobenzoyl)-N-[(Z)-pyridin-4-ylmethylideneamino]piperidine-4-carboxamide