| MolName | N'-[(Z)-naphthalen-1-ylmethylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide |
| MolecularFormula | C20H14N3O2F3 |
| Smiles | O=C(C(N/N=C\c1cccc2ccccc12)=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H14F3N3O2/c21-20(22,23)15-8-4-9-16(11-15)25-18(27)19(28)26-24-12-14-7-3-6-13-5-1-2-10-17(13)14/h1-12H,(H,25,27)(H,26,28) |
| InChIK | BCXUMJHPVZQWDC-UHFFFAOYSA-N |
| TotalMolweight | 385.344 |
| Molweight | 385.344 |
| MonoisotopicMass | 385.103811 |
| CLogP | 4.1866 |
| CLogS | -5.909 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 280.26 |
| Relative PSA | 0.21591 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | -3.4422 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-naphthalen-1-ylmethylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide | 2 - N'-[(Z)-naphthalen-1-ylmethylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide