| MolName | benzyl N-[2-oxo-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]ethyl]carbamate |
| MolecularFormula | C16H16N4O3 |
| Smiles | O=C(CNC(OCc1ccccc1)=O)N/N=C\c1ccncc1 |
| InChI | InChI=1S/C16H16N4O3/c21-15(20-19-10-13-6-8-17-9-7-13)11-18-16(22)23-12-14-4-2-1-3-5-14/h1-10H,11-12H2,(H,18,22)(H,20,21) |
| InChIK | BCXVSADJSNORAO-UHFFFAOYSA-N |
| TotalMolweight | 312.328 |
| Molweight | 312.328 |
| MonoisotopicMass | 312.122241 |
| CLogP | 1.4619 |
| CLogS | -3.161 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 252.48 |
| Relative PSA | 0.32272 |
| PolarSurfaceArea | 92.68 |
| Druglikeness | -8.7267 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73913 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - benzyl N-[2-oxo-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]ethyl]carbamate | 2 - benzyl N-[2-oxo-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]ethyl]carbamate