| MolName | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C15H12N5O2ClS |
| Smiles | Nc1nnc(CC(N/N=C\c2ccc(-c(cccc3)c3Cl)o2)=O)s1 |
| InChI | InChI=1S/C15H12ClN5O2S/c16-11-4-2-1-3-10(11)12-6-5-9(23-12)8-18-19-13(22)7-14-20-21-15(17)24-14/h1-6,8H,7H2,(H2,17,21)(H,19,22) |
| InChIK | BCZFTXPAADWHHR-UHFFFAOYSA-N |
| TotalMolweight | 361.812 |
| Molweight | 361.812 |
| MonoisotopicMass | 361.040022 |
| CLogP | 2.9103 |
| CLogS | -5.165 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 267.6 |
| Relative PSA | 0.40243 |
| PolarSurfaceArea | 134.64 |
| Druglikeness | 7.7682 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]acetamide