| MolName | N-[(Z)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-3-phenylsulfanylpropanamide |
| MolecularFormula | C23H21N2O2ClS |
| Smiles | O=C(CCSc1ccccc1)N/N=C\c(cc1)ccc1OCc(cccc1)c1Cl |
| InChI | InChI=1S/C23H21ClN2O2S/c24-22-9-5-4-6-19(22)17-28-20-12-10-18(11-13-20)16-25-26-23(27)14-15-29-21-7-2-1-3-8-21/h1-13,16H,14-15,17H2,(H,26,27) |
| InChIK | BDAJFMFDAOITHT-UHFFFAOYSA-N |
| TotalMolweight | 424.951 |
| Molweight | 424.951 |
| MonoisotopicMass | 424.101225 |
| CLogP | 5.8229 |
| CLogS | -6.61 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 330.94 |
| Relative PSA | 0.19188 |
| PolarSurfaceArea | 75.99 |
| Druglikeness | 4.2417 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72414 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-3-phenylsulfanylpropanamide | 2 - N-[(Z)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-3-phenylsulfanylpropanamide