| MolName | 2-(azepan-1-ium-1-yl)-N-[(Z)-(2-chlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C15H21N3OCl |
| Smiles | O=C(C[NH+]1CCCCCC1)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C15H20ClN3O/c16-14-8-4-3-7-13(14)11-17-18-15(20)12-19-9-5-1-2-6-10-19/h3-4,7-8,11H,1-2,5-6,9-10,12H2,(H,18,20)/p+1 |
| InChIK | BDBPVRDBAUQHSZ-UHFFFAOYSA-O |
| TotalMolweight | 294.805 |
| Molweight | 294.805 |
| MonoisotopicMass | 294.137314 |
| CLogP | 1.0226 |
| CLogS | -3.636 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 249.81 |
| Relative PSA | 0.21456 |
| PolarSurfaceArea | 45.9 |
| Druglikeness | -1.2855 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 3 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(azepan-1-ium-1-yl)-N-[(Z)-(2-chlorophenyl)methylideneamino]acetamide | 2 - 2-(azepan-1-ium-1-yl)-N-[(Z)-(2-chlorophenyl)methylideneamino]acetamide